C26H29N5O3 — CID 10600007
4-methoxy-N-[2-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoylamino]phenyl]benzamide (PubChem CID 10600007) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoylamino]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 10600007 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 4-methoxy-N-[2-[(1-pyridin-4-ylpiperidin-4-yl)methylcarbamoylamino]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)NCC2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C26H29N5O3/c1-34-22-8-6-20(7-9-22)25(32)29-23-4-2-3-5-24(23)30-26(33)28-18-19-12-16-31(17-13-19)21-10-14-27-15-11-21/h2-11,14-15,19H,12-13,16-18H2,1H3,(H,29,32)(H2,28,30,33) |
| InChIKey | WCTNXYFGWOEMDP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |