C17H29N3O3 — CID 106000286
tert-butyl N-[2-[3-[2-(oxan-2-yl)ethyl]imidazol-4-yl]ethyl]carbamate (PubChem CID 106000286) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-(oxan-2-yl)ethyl]imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-(oxan-2-yl)ethyl]imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 106000286 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl N-[2-[3-[2-(oxan-2-yl)ethyl]imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cncn1CCC1CCCCO1 |
| InChI | InChI=1S/C17H29N3O3/c1-17(2,3)23-16(21)19-9-7-14-12-18-13-20(14)10-8-15-6-4-5-11-22-15/h12-13,15H,4-11H2,1-3H3,(H,19,21) |
| InChIKey | MVJDYVLLFNNGMI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |