About N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide
N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide (PubChem CID 106001546) has the molecular formula C10H15F2NO4S2
and a molecular weight of 315.36 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide |
| PubChem CID | 106001546 |
| Molecular Formula | C10H15F2NO4S2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide |
| SMILES | Cc1csc(CO)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C10H15F2NO4S2/c1-7-6-18-8(4-14)10(7)19(15,16)13-2-3-17-5-9(11)12/h6,9,13-14H,2-5H2,1H3 |
| InChIKey | XNABQNSLLVIDTN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide?
The IUPAC name of N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide (CID 106001546) is N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide.
What is the SMILES notation for N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide?
The canonical SMILES for N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide is Cc1csc(CO)c1S(=O)(=O)NCCOCC(F)F.
What is the InChIKey of N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide?
The InChIKey is XNABQNSLLVIDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO4S2/c1-7-6-18-8(4-14)10(7)19(15,16)13-2-3-17-5-9(11)12/h6,9,13-14H,2-5H2,1H3.
What are the key properties of N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide?
N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide has a molecular weight of 315.36 g/mol, XLogP of 1.11, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide is sourced from PubChem (CID 106001546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).