C14H21ClN2O3 — CID 106003024
6-chloro-3-[2-(oxan-2-yl)ethyl]-5-propyl-1H-pyrimidine-2,4-dione (PubChem CID 106003024) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 6-chloro-3-[2-(oxan-2-yl)ethyl]-5-propyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-[2-(oxan-2-yl)ethyl]-5-propyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106003024 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 6-chloro-3-[2-(oxan-2-yl)ethyl]-5-propyl-1H-pyrimidine-2,4-dione |
| SMILES | CCCc1c(Cl)[nH]c(=O)n(CCC2CCCCO2)c1=O |
| InChI | InChI=1S/C14H21ClN2O3/c1-2-5-11-12(15)16-14(19)17(13(11)18)8-7-10-6-3-4-9-20-10/h10H,2-9H2,1H3,(H,16,19) |
| InChIKey | KFYWWVBSLFRMJY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |