C31H48O3 — CID 10600394
methyl 2-[(5Z)-5-[(4E,8E,12E)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoate (PubChem CID 10600394) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(4E,8E,12E)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(5Z)-5-[(4E,8E,12E)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10600394 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | methyl 2-[(5Z)-5-[(4E,8E,12E)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CC/C(=C/CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO1 |
| InChI | InChI=1S/C31H48O3/c1-24(2)13-10-15-26(4)17-12-19-27(5)18-11-16-25(3)14-8-9-20-29-21-22-30(34-23-29)28(6)31(32)33-7/h13-14,17-18,20,30H,6,8-12,15-16,19,21-23H2,1-5,7H3/b25-14+,26-17+,27-18+,29-20- |
| InChIKey | NLYDDJJNAFUBBU-ZQOOWAPUSA-N |
| XLogP | 8.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|