C12H17N3O4S — CID 106005640
2-[(2-amino-2-oxoethyl)-[(5-ethylthiophen-2-yl)methylcarbamoyl]amino]acetic acid (PubChem CID 106005640) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(5-ethylthiophen-2-yl)methylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(5-ethylthiophen-2-yl)methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 106005640 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(5-ethylthiophen-2-yl)methylcarbamoyl]amino]acetic acid |
| SMILES | CCc1ccc(CNC(=O)N(CC(N)=O)CC(=O)O)s1 |
| InChI | InChI=1S/C12H17N3O4S/c1-2-8-3-4-9(20-8)5-14-12(19)15(6-10(13)16)7-11(17)18/h3-4H,2,5-7H2,1H3,(H2,13,16)(H,14,19)(H,17,18) |
| InChIKey | CFPZFMLWAKDRNL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |