C19H29N3O7S2 — CID 10600645
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 10600645) has the molecular formula C19H29N3O7S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10600645 |
| Molecular Formula | C19H29N3O7S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](N3CCS(=O)(=O)CC3)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C19H29N3O7S2/c1-2-3-10-29-16-4-6-17(7-5-16)31(27,28)22-14-15(13-18(22)19(23)20-24)21-8-11-30(25,26)12-9-21/h4-7,15,18,24H,2-3,8-14H2,1H3,(H,20,23)/t15-,18+/m0/s1 |
| InChIKey | HPIJZAVGIHKGTA-MAUKXSAKSA-N |
| XLogP | 0.23 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|