C13H15FN2O2S2 — CID 106006794
2-amino-N-[(5-ethylthiophen-2-yl)methyl]-4-fluorobenzenesulfonamide (PubChem CID 106006794) has the molecular formula C13H15FN2O2S2 and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-amino-N-[(5-ethylthiophen-2-yl)methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-amino-N-[(5-ethylthiophen-2-yl)methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106006794 |
| Molecular Formula | C13H15FN2O2S2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-amino-N-[(5-ethylthiophen-2-yl)methyl]-4-fluorobenzenesulfonamide |
| SMILES | CCc1ccc(CNS(=O)(=O)c2ccc(F)cc2N)s1 |
| InChI | InChI=1S/C13H15FN2O2S2/c1-2-10-4-5-11(19-10)8-16-20(17,18)13-6-3-9(14)7-12(13)15/h3-7,16H,2,8,15H2,1H3 |
| InChIKey | ZKPLMAYSRNHCSM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|