C13H14Br2N2O2S2 — CID 106007249
N-(2,5-dibromophenyl)-2-(ethylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106007249) has the molecular formula C13H14Br2N2O2S2 and a molecular weight of 454.21 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-2-(ethylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(2,5-dibromophenyl)-2-(ethylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106007249 |
| Molecular Formula | C13H14Br2N2O2S2 |
| Molecular Weight | 454.21 g/mol |
| Exact Mass | 451.89 |
| IUPAC Name | N-(2,5-dibromophenyl)-2-(ethylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCNCc1sccc1S(=O)(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H14Br2N2O2S2/c1-2-16-8-12-13(5-6-20-12)21(18,19)17-11-7-9(14)3-4-10(11)15/h3-7,16-17H,2,8H2,1H3 |
| InChIKey | AGJDYFQHFAINAO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |