C26H46O4Si2 — CID 10600733
tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane (PubChem CID 10600733) has the molecular formula C26H46O4Si2 and a molecular weight of 478.82 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10600733 |
| Molecular Formula | C26H46O4Si2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12[C@H]3C=C[C@](C)(O3)[C@]1(CO[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@]2(C)O1 |
| InChI | InChI=1S/C26H46O4Si2/c1-21(2,3)31(9,10)27-17-25-19-13-16-24(8,29-19)26(25,20-14-15-23(25,7)30-20)18-28-32(11,12)22(4,5)6/h13-16,19-20H,17-18H2,1-12H3/t19-,20-,23+,24+,25+,26+/m1/s1 |
| InChIKey | NGIREDQDDROPEO-QBLBKIJQSA-N |
| XLogP | 6.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|