About 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine
5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine (PubChem CID 106007437) has the molecular formula C14H15N3S2
and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine |
| PubChem CID | 106007437 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine |
| SMILES | CCc1ccc(CNc2ccc3scnc3c2N)s1 |
| InChI | InChI=1S/C14H15N3S2/c1-2-9-3-4-10(19-9)7-16-11-5-6-12-14(13(11)15)17-8-18-12/h3-6,8,16H,2,7,15H2,1H3 |
| InChIKey | WBAYZWDNFMHACF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine?
The IUPAC name of 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine (CID 106007437) is 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine.
What is the SMILES notation for 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine?
The canonical SMILES for 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine is CCc1ccc(CNc2ccc3scnc3c2N)s1.
What is the InChIKey of 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine?
The InChIKey is WBAYZWDNFMHACF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3S2/c1-2-9-3-4-10(19-9)7-16-11-5-6-12-14(13(11)15)17-8-18-12/h3-6,8,16H,2,7,15H2,1H3.
What are the key properties of 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine?
5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine has a molecular weight of 289.43 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[(5-ethylthiophen-2-yl)methyl]-1,3-benzothiazole-4,5-diamine is sourced from PubChem (CID 106007437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).