C17H30N2O — CID 106008311
6,6-dimethyl-1-(4-propan-2-yloxybutyl)-5,7-dihydro-4H-indol-4-amine (PubChem CID 106008311) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-propan-2-yloxybutyl)-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 6,6-dimethyl-1-(4-propan-2-yloxybutyl)-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 106008311 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 6,6-dimethyl-1-(4-propan-2-yloxybutyl)-5,7-dihydro-4H-indol-4-amine |
| SMILES | CC(C)OCCCCn1ccc2c1CC(C)(C)CC2N |
| InChI | InChI=1S/C17H30N2O/c1-13(2)20-10-6-5-8-19-9-7-14-15(18)11-17(3,4)12-16(14)19/h7,9,13,15H,5-6,8,10-12,18H2,1-4H3 |
| InChIKey | XFPHFOAIYHAZCL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|