C25H34N6O4 — CID 10600844
(2R)-N'-hydroxy-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 10600844) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 10600844 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C25H34N6O4/c1-17(2)12-18(14-23(32)30-35)24(33)29-22(13-19-15-28-21-7-4-3-6-20(19)21)25(34)27-8-5-10-31-11-9-26-16-31/h3-4,6-7,9,11,15-18,22,28,35H,5,8,10,12-14H2,1-2H3,(H,27,34)(H,29,33)(H,30,32)/t18-,22+/m1/s1 |
| InChIKey | YUPQCEGDWHZIJW-GCJKJVERSA-N |
| XLogP | 2.16 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|