C26H44O8 — CID 10600909
2,3,5,6-tetrakis(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene (PubChem CID 10600909) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,3,5,6-tetrakis(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 10600909 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2,3,5,6-tetrakis(2-methoxyethoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
| SMILES | COCCOCC1=C(COCCOC)C2C(COCCOC)=C(COCCOC)C1C2=C(C)C |
| InChI | InChI=1S/C26H44O8/c1-19(2)24-25-20(15-31-11-7-27-3)21(16-32-12-8-28-4)26(24)23(18-34-14-10-30-6)22(25)17-33-13-9-29-5/h25-26H,7-18H2,1-6H3 |
| InChIKey | NZLUNOLFKZXEPI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|