C22H30Cl2N4O4 — CID 10600933
(3S)-3-(5,6-dichloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 10600933) has the molecular formula C22H30Cl2N4O4 and a molecular weight of 485.41 g/mol. Its IUPAC name is (3S)-3-(5,6-dichloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(5,6-dichloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10600933 |
| Molecular Formula | C22H30Cl2N4O4 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (3S)-3-(5,6-dichloro-3-pyridinyl)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H30Cl2N4O4/c23-17-10-16(12-26-21(17)24)18(11-20(30)31)27-22(32)15-2-1-9-28(13-15)19(29)4-3-14-5-7-25-8-6-14/h10,12,14-15,18,25H,1-9,11,13H2,(H,27,32)(H,30,31)/t15-,18+/m1/s1 |
| InChIKey | HDNLLSLLYCIFIU-QAPCUYQASA-N |
| XLogP | 3.04 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|