C30H34O6 — CID 10601137
(5S,7R,8R,9R,10R)-8,9-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-10-ol (PubChem CID 10601137) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (5S,7R,8R,9R,10R)-8,9-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-10-ol.
| Compound Name | (5S,7R,8R,9R,10R)-8,9-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-10-ol |
|---|---|
| PubChem CID | 10601137 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (5S,7R,8R,9R,10R)-8,9-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]decan-10-ol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@]12CCCO2 |
| InChI | InChI=1S/C30H34O6/c31-29-28(34-21-25-15-8-3-9-16-25)27(33-20-24-13-6-2-7-14-24)26(36-30(29)17-10-18-35-30)22-32-19-23-11-4-1-5-12-23/h1-9,11-16,26-29,31H,10,17-22H2/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | IKWGVSISVZBXEI-RLXMVLCYSA-N |
| XLogP | 4.64 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |