C33H35NO3 — CID 10601243
(3S,6R)-1-benzyl-3-[3,4-bis(phenylmethoxy)phenyl]-6-methylpiperidin-3-ol (PubChem CID 10601243) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (3S,6R)-1-benzyl-3-[3,4-bis(phenylmethoxy)phenyl]-6-methylpiperidin-3-ol.
| Compound Name | (3S,6R)-1-benzyl-3-[3,4-bis(phenylmethoxy)phenyl]-6-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 10601243 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (3S,6R)-1-benzyl-3-[3,4-bis(phenylmethoxy)phenyl]-6-methylpiperidin-3-ol |
| SMILES | C[C@@H]1CC[C@](O)(c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C33H35NO3/c1-26-19-20-33(35,25-34(26)22-27-11-5-2-6-12-27)30-17-18-31(36-23-28-13-7-3-8-14-28)32(21-30)37-24-29-15-9-4-10-16-29/h2-18,21,26,35H,19-20,22-25H2,1H3/t26-,33-/m1/s1 |
| InChIKey | CWAVPPPUCBLCGY-UTONBFNKSA-N |
| XLogP | 6.72 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |