C25H44O2Sn — CID 10601293
ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-tributylstannylnona-2,4,6,8-tetraenoate (PubChem CID 10601293) has the molecular formula C25H44O2Sn and a molecular weight of 495.34 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-tributylstannylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-tributylstannylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 10601293 |
| Molecular Formula | C25H44O2Sn |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-tributylstannylnona-2,4,6,8-tetraenoate |
| SMILES | CCCC[Sn](/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C13H17O2.3C4H9.Sn/c1-5-11(3)8-7-9-12(4)10-13(14)15-6-2;3*1-3-4-2;/h1,5,7-10H,6H2,2-4H3;3*1,3-4H2,2H3;/b5-1?,9-7+,11-8+,12-10+;;;; |
| InChIKey | JIJFONRYDPCRTA-GQTMLXNTSA-N |
| XLogP | 7.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|