C16H10F5N5O4S2 — CID 10601296
2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 10601296) has the molecular formula C16H10F5N5O4S2 and a molecular weight of 495.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10601296 |
| Molecular Formula | C16H10F5N5O4S2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccnc(NS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C16H10F5N5O4S2/c17-10-11(18)13(20)15(14(21)12(10)19)32(29,30)26-16-23-6-5-9(25-16)24-7-1-3-8(4-2-7)31(22,27)28/h1-6H,(H2,22,27,28)(H2,23,24,25,26) |
| InChIKey | OJHDVAOAFKILCS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|