C28H37N5O4 — CID 10601709
3-[5-(3-aminophenyl)-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 10601709) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-[5-(3-aminophenyl)-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[5-(3-aminophenyl)-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10601709 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 3-[5-(3-aminophenyl)-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | Nc1cccc(-c2cncc(C(CC(=O)O)NC(=O)C3CCCN(C(=O)CCC4CCNCC4)C3)c2)c1 |
| InChI | InChI=1S/C28H37N5O4/c29-24-5-1-3-20(14-24)22-13-23(17-31-16-22)25(15-27(35)36)32-28(37)21-4-2-12-33(18-21)26(34)7-6-19-8-10-30-11-9-19/h1,3,5,13-14,16-17,19,21,25,30H,2,4,6-12,15,18,29H2,(H,32,37)(H,35,36) |
| InChIKey | GHKOZFUXJGLMAL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|