C11H21N5O2S — CID 106018187
4-(aminomethyl)-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-sulfonamide (PubChem CID 106018187) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106018187 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-(aminomethyl)-N-[(1-methylpyrazol-4-yl)methyl]piperidine-1-sulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)N2CCC(CN)CC2)cn1 |
| InChI | InChI=1S/C11H21N5O2S/c1-15-9-11(7-13-15)8-14-19(17,18)16-4-2-10(6-12)3-5-16/h7,9-10,14H,2-6,8,12H2,1H3 |
| InChIKey | DKSLUKYMECYQRJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |