C10H19N3S — CID 106019341
4-octan-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 106019341) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 4-octan-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-octan-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106019341 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-octan-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCC(CCC)n1cn[nH]c1=S |
| InChI | InChI=1S/C10H19N3S/c1-3-5-7-9(6-4-2)13-8-11-12-10(13)14/h8-9H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | XAFWZVMPFGOKCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|