C13H18N4O3 — CID 106020904
5-[(1-methylpyrrolidin-2-yl)methylcarbamoylamino]pyridine-2-carboxylic acid (PubChem CID 106020904) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[(1-methylpyrrolidin-2-yl)methylcarbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-[(1-methylpyrrolidin-2-yl)methylcarbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106020904 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-[(1-methylpyrrolidin-2-yl)methylcarbamoylamino]pyridine-2-carboxylic acid |
| SMILES | CN1CCCC1CNC(=O)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C13H18N4O3/c1-17-6-2-3-10(17)8-15-13(20)16-9-4-5-11(12(18)19)14-7-9/h4-5,7,10H,2-3,6,8H2,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | AIFYCPJASOBWRU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |