C19H31N — CID 106023724
4-methyl-N-octan-4-yl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 106023724) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-methyl-N-octan-4-yl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 4-methyl-N-octan-4-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 106023724 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 4-methyl-N-octan-4-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCCCC(CCC)NC1CCC(C)c2ccccc21 |
| InChI | InChI=1S/C19H31N/c1-4-6-10-16(9-5-2)20-19-14-13-15(3)17-11-7-8-12-18(17)19/h7-8,11-12,15-16,19-20H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | GVCPJDSPIKKWMA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |