C13H16BrN3 — CID 106024719
3-bromo-4-[(1-methylpyrrolidin-2-yl)methylamino]benzonitrile (PubChem CID 106024719) has the molecular formula C13H16BrN3 and a molecular weight of 294.20 g/mol. Its IUPAC name is 3-bromo-4-[(1-methylpyrrolidin-2-yl)methylamino]benzonitrile.
| Compound Name | 3-bromo-4-[(1-methylpyrrolidin-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 106024719 |
| Molecular Formula | C13H16BrN3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-bromo-4-[(1-methylpyrrolidin-2-yl)methylamino]benzonitrile |
| SMILES | CN1CCCC1CNc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C13H16BrN3/c1-17-6-2-3-11(17)9-16-13-5-4-10(8-15)7-12(13)14/h4-5,7,11,16H,2-3,6,9H2,1H3 |
| InChIKey | QOZRTJZWKXAYRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |