About [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate
[4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate (PubChem CID 10602531) has the molecular formula C32H28O8
and a molecular weight of 540.57 g/mol. Its IUPAC name is [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate.
Molecular Properties
| Compound Name | [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate |
| PubChem CID | 10602531 |
| Molecular Formula | C32H28O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(Oc1ccc(C2(c3ccc(OC(=O)c4ccc(O)cc4O)cc3)CCCCC2)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C32H28O8/c33-22-8-14-26(28(35)18-22)30(37)39-24-10-4-20(5-11-24)32(16-2-1-3-17-32)21-6-12-25(13-7-21)40-31(38)27-15-9-23(34)19-29(27)36/h4-15,18-19,33-36H,1-3,16-17H2 |
| InChIKey | MEWVUUGXUZOQCA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate?
The IUPAC name of [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate (CID 10602531) is [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate.
What is the SMILES notation for [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate?
The canonical SMILES for [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate is O=C(Oc1ccc(C2(c3ccc(OC(=O)c4ccc(O)cc4O)cc3)CCCCC2)cc1)c1ccc(O)cc1O.
What is the InChIKey of [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate?
The InChIKey is MEWVUUGXUZOQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H28O8/c33-22-8-14-26(28(35)18-22)30(37)39-24-10-4-20(5-11-24)32(16-2-1-3-17-32)21-6-12-25(13-7-21)40-31(38)27-15-9-23(34)19-29(27)36/h4-15,18-19,33-36H,1-3,16-17H2.
What are the key properties of [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate?
[4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate has a molecular weight of 540.57 g/mol, XLogP of 6.20, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-[4-(2,4-dihydroxybenzoyl)oxyphenyl]cyclohexyl]phenyl] 2,4-dihydroxybenzoate is sourced from PubChem (CID 10602531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).