C16H20FN3O — CID 106027566
4-(3-aminoprop-1-ynyl)-2-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]benzamide (PubChem CID 106027566) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-2-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106027566 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-[(1-methylpyrrolidin-2-yl)methyl]benzamide |
| SMILES | CN1CCCC1CNC(=O)c1ccc(C#CCN)cc1F |
| InChI | InChI=1S/C16H20FN3O/c1-20-9-3-5-13(20)11-19-16(21)14-7-6-12(4-2-8-18)10-15(14)17/h6-7,10,13H,3,5,8-9,11,18H2,1H3,(H,19,21) |
| InChIKey | YCKRCXYJHZXTQH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|