C14H26N4O2S — CID 106027786
N-(cyclohexylmethyl)-1-[2-(ethylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 106027786) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-[2-(ethylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-(cyclohexylmethyl)-1-[2-(ethylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106027786 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(cyclohexylmethyl)-1-[2-(ethylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCNCCn1cc(S(=O)(=O)NCC2CCCCC2)cn1 |
| InChI | InChI=1S/C14H26N4O2S/c1-2-15-8-9-18-12-14(11-16-18)21(19,20)17-10-13-6-4-3-5-7-13/h11-13,15,17H,2-10H2,1H3 |
| InChIKey | CHGPDAJWJQAYGD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|