C29H40N6O3S — CID 10602797
N-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]hexyl]-N-methyl-4-(1,3-thiazolidin-3-ylmethyl)benzamide (PubChem CID 10602797) has the molecular formula C29H40N6O3S and a molecular weight of 552.75 g/mol. Its IUPAC name is N-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]hexyl]-N-methyl-4-(1,3-thiazolidin-3-ylmethyl)benzamide.
| Compound Name | N-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]hexyl]-N-methyl-4-(1,3-thiazolidin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 10602797 |
| Molecular Formula | C29H40N6O3S |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | N-[6-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]hexyl]-N-methyl-4-(1,3-thiazolidin-3-ylmethyl)benzamide |
| SMILES | COc1cc2nc(N(C)CCCCCCN(C)C(=O)c3ccc(CN4CCSC4)cc3)nc(N)c2cc1OC |
| InChI | InChI=1S/C29H40N6O3S/c1-33(28(36)22-11-9-21(10-12-22)19-35-15-16-39-20-35)13-7-5-6-8-14-34(2)29-31-24-18-26(38-4)25(37-3)17-23(24)27(30)32-29/h9-12,17-18H,5-8,13-16,19-20H2,1-4H3,(H2,30,31,32) |
| InChIKey | YFEUUISKXLCYAK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|