C15H26ClN5 — CID 106028150
4-chloro-N-octan-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 106028150) has the molecular formula C15H26ClN5 and a molecular weight of 311.86 g/mol. Its IUPAC name is 4-chloro-N-octan-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-octan-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106028150 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 4-chloro-N-octan-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCC(CCC)Nc1nc(Cl)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H26ClN5/c1-3-5-9-12(8-4-2)17-14-18-13(16)19-15(20-14)21-10-6-7-11-21/h12H,3-11H2,1-2H3,(H,17,18,19,20) |
| InChIKey | KSEDJCYOYJGRBI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |