C26H23ClIN3O — CID 10602865
1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 10602865) has the molecular formula C26H23ClIN3O and a molecular weight of 555.85 g/mol. Its IUPAC name is 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 10602865 |
| Molecular Formula | C26H23ClIN3O |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | O=C(Cc1ccncc1)N1CCC(=C2c3ccc(Cl)cc3CCc3cc(I)cnc32)CC1 |
| InChI | InChI=1S/C26H23ClIN3O/c27-21-3-4-23-19(14-21)1-2-20-15-22(28)16-30-26(20)25(23)18-7-11-31(12-8-18)24(32)13-17-5-9-29-10-6-17/h3-6,9-10,14-16H,1-2,7-8,11-13H2 |
| InChIKey | MPTURSPBHFWZFL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|