C34H40O3SSi — CID 10602886
[(9E)-4-(benzenesulfonyl)dodeca-4,5,9,11-tetraenoxy]-tert-butyl-diphenylsilane (PubChem CID 10602886) has the molecular formula C34H40O3SSi and a molecular weight of 556.84 g/mol. Its IUPAC name is [(9E)-4-(benzenesulfonyl)dodeca-4,5,9,11-tetraenoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(9E)-4-(benzenesulfonyl)dodeca-4,5,9,11-tetraenoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10602886 |
| Molecular Formula | C34H40O3SSi |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [(9E)-4-(benzenesulfonyl)dodeca-4,5,9,11-tetraenoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C/C=C/CCC=C=C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H40O3SSi/c1-5-6-7-8-9-13-21-31(38(35,36)30-22-14-10-15-23-30)24-20-29-37-39(34(2,3)4,32-25-16-11-17-26-32)33-27-18-12-19-28-33/h5-7,10-19,22-23,25-28H,1,8-9,20,24,29H2,2-4H3/b7-6+ |
| InChIKey | ROOQPUCFLDPJMQ-VOTSOKGWSA-N |
| XLogP | 7.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|