C17H25N3S — CID 106029214
5-N-octan-4-yl-4-phenyl-1,2-thiazole-3,5-diamine (PubChem CID 106029214) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 5-N-octan-4-yl-4-phenyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-octan-4-yl-4-phenyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 106029214 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 5-N-octan-4-yl-4-phenyl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCC(CCC)Nc1snc(N)c1-c1ccccc1 |
| InChI | InChI=1S/C17H25N3S/c1-3-5-12-14(9-4-2)19-17-15(16(18)20-21-17)13-10-7-6-8-11-13/h6-8,10-11,14,19H,3-5,9,12H2,1-2H3,(H2,18,20) |
| InChIKey | FRUDJLCZGQZEDA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |