C16H14O6 — CID 10603
7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol (PubChem CID 10603) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol.
| Compound Name | 7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol |
|---|---|
| PubChem CID | 10603 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol |
| SMILES | Oc1cc2c(cc1O)C1c3ccc(O)c(O)c3OCC1(O)C2 |
| InChI | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2 |
| InChIKey | WZUVPPKBWHMQCE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|