C29H47NO8Si — CID 10603042
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(R)-hydroxy-[(1R,2S,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 10603042) has the molecular formula C29H47NO8Si and a molecular weight of 565.78 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(R)-hydroxy-[(1R,2S,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(R)-hydroxy-[(1R,2S,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10603042 |
| Molecular Formula | C29H47NO8Si |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(R)-hydroxy-[(1R,2S,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@H](O)[C@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H47NO8Si/c1-28(2,3)37-27(33)30-15-19(38-39(7,8)29(4,5)6)14-20(30)23(31)22-24(32)21-17-35-26(36-21)25(22)34-16-18-12-10-9-11-13-18/h9-13,19-26,31-32H,14-17H2,1-8H3/t19-,20+,21-,22+,23+,24-,25-,26-/m1/s1 |
| InChIKey | JFLUZICCMZCWQI-XHGRUUOTSA-N |
| XLogP | 4.06 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|