C36H39N7 — CID 10603122
N,9-bis(prop-2-enyl)-2-[4-(2,2,2-triphenylethylamino)piperidin-1-yl]purin-6-amine (PubChem CID 10603122) has the molecular formula C36H39N7 and a molecular weight of 569.76 g/mol. Its IUPAC name is N,9-bis(prop-2-enyl)-2-[4-(2,2,2-triphenylethylamino)piperidin-1-yl]purin-6-amine.
| Compound Name | N,9-bis(prop-2-enyl)-2-[4-(2,2,2-triphenylethylamino)piperidin-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 10603122 |
| Molecular Formula | C36H39N7 |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | N,9-bis(prop-2-enyl)-2-[4-(2,2,2-triphenylethylamino)piperidin-1-yl]purin-6-amine |
| SMILES | C=CCNc1nc(N2CCC(NCC(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)nc2c1ncn2CC=C |
| InChI | InChI=1S/C36H39N7/c1-3-22-37-33-32-34(43(23-4-2)27-39-32)41-35(40-33)42-24-20-31(21-25-42)38-26-36(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h3-19,27,31,38H,1-2,20-26H2,(H,37,40,41) |
| InChIKey | WSZOQRFRJXPNEG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|