C10H13N3O3S2 — CID 106031932
5-(ethylaminomethyl)-N-(1,3-thiazol-2-yl)furan-2-sulfonamide (PubChem CID 106031932) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(1,3-thiazol-2-yl)furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(1,3-thiazol-2-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106031932 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(1,3-thiazol-2-yl)furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)Nc2nccs2)o1 |
| InChI | InChI=1S/C10H13N3O3S2/c1-2-11-7-8-3-4-9(16-8)18(14,15)13-10-12-5-6-17-10/h3-6,11H,2,7H2,1H3,(H,12,13) |
| InChIKey | FMXHHXSLSYZGHR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |