C14H13BrClNOS — CID 106033728
N-[2-(5-bromothiophen-2-yl)ethyl]-3-(chloromethyl)benzamide (PubChem CID 106033728) has the molecular formula C14H13BrClNOS and a molecular weight of 358.69 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-3-(chloromethyl)benzamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(chloromethyl)benzamide |
|---|---|
| PubChem CID | 106033728 |
| Molecular Formula | C14H13BrClNOS |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(chloromethyl)benzamide |
| SMILES | O=C(NCCc1ccc(Br)s1)c1cccc(CCl)c1 |
| InChI | InChI=1S/C14H13BrClNOS/c15-13-5-4-12(19-13)6-7-17-14(18)11-3-1-2-10(8-11)9-16/h1-5,8H,6-7,9H2,(H,17,18) |
| InChIKey | NALHBVSLQMDTGJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|