C20H36N6O7 — CID 10603422
(2S)-2-[[(2S)-3-carboxy-2-[[2-[6-(diaminomethylideneamino)hexanoyl-ethylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 10603422) has the molecular formula C20H36N6O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[[2-[6-(diaminomethylideneamino)hexanoyl-ethylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[6-(diaminomethylideneamino)hexanoyl-ethylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10603422 |
| Molecular Formula | C20H36N6O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[[2-[6-(diaminomethylideneamino)hexanoyl-ethylamino]acetyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCN(CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)C(C)C)C(=O)CCCCCN=C(N)N |
| InChI | InChI=1S/C20H36N6O7/c1-4-26(15(28)8-6-5-7-9-23-20(21)22)11-14(27)24-13(10-16(29)30)18(31)25-17(12(2)3)19(32)33/h12-13,17H,4-11H2,1-3H3,(H,24,27)(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23)/t13-,17-/m0/s1 |
| InChIKey | IDTGIVSZMCVQCC-GUYCJALGSA-N |
| XLogP | -1.15 |
| TPSA | 217.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|