C13H16FN3O2S2 — CID 106034297
5-amino-2-fluoro-4-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 106034297) has the molecular formula C13H16FN3O2S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-4-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106034297 |
| Molecular Formula | C13H16FN3O2S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-amino-2-fluoro-4-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cc(N)c(C)cc2F)cs1 |
| InChI | InChI=1S/C13H16FN3O2S2/c1-8-5-11(14)13(6-12(8)15)21(18,19)16-4-3-10-7-20-9(2)17-10/h5-7,16H,3-4,15H2,1-2H3 |
| InChIKey | LSPCTHBBWGPPTH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|