C29H24N4O6S2 — CID 10603457
N,N'-bis[2-(2-nitrophenyl)sulfanylphenyl]pentanediamide (PubChem CID 10603457) has the molecular formula C29H24N4O6S2 and a molecular weight of 588.67 g/mol. Its IUPAC name is N,N'-bis[2-(2-nitrophenyl)sulfanylphenyl]pentanediamide.
| Compound Name | N,N'-bis[2-(2-nitrophenyl)sulfanylphenyl]pentanediamide |
|---|---|
| PubChem CID | 10603457 |
| Molecular Formula | C29H24N4O6S2 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | N,N'-bis[2-(2-nitrophenyl)sulfanylphenyl]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccccc1Sc1ccccc1[N+](=O)[O-])Nc1ccccc1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N4O6S2/c34-28(30-20-10-1-5-14-24(20)40-26-16-7-3-12-22(26)32(36)37)18-9-19-29(35)31-21-11-2-6-15-25(21)41-27-17-8-4-13-23(27)33(38)39/h1-8,10-17H,9,18-19H2,(H,30,34)(H,31,35) |
| InChIKey | KHEZDUJBCYFBSI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|