C14H16ClN5 — CID 106036565
2-(1-chloroethyl)-1-[(1,5-dimethylpyrazol-4-yl)methyl]imidazo[4,5-c]pyridine (PubChem CID 106036565) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-[(1,5-dimethylpyrazol-4-yl)methyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(1-chloroethyl)-1-[(1,5-dimethylpyrazol-4-yl)methyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 106036565 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(1-chloroethyl)-1-[(1,5-dimethylpyrazol-4-yl)methyl]imidazo[4,5-c]pyridine |
| SMILES | Cc1c(Cn2c(C(C)Cl)nc3cnccc32)cnn1C |
| InChI | InChI=1S/C14H16ClN5/c1-9(15)14-18-12-7-16-5-4-13(12)20(14)8-11-6-17-19(3)10(11)2/h4-7,9H,8H2,1-3H3 |
| InChIKey | IJZXWNDYGZCDDI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|