About [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate
[5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 10603671) has the molecular formula C13H3F9O11S3
and a molecular weight of 602.34 g/mol. Its IUPAC name is [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
| PubChem CID | 10603671 |
| Molecular Formula | C13H3F9O11S3 |
| Molecular Weight | 602.34 g/mol |
| Exact Mass | 601.87 |
| IUPAC Name | [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | O=C1C=C(OS(=O)(=O)C(F)(F)F)C(=O)c2c(OS(=O)(=O)C(F)(F)F)ccc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C13H3F9O11S3/c14-11(15,16)34(25,26)31-5-1-2-6(32-35(27,28)12(17,18)19)9-8(5)4(23)3-7(10(9)24)33-36(29,30)13(20,21)22/h1-3H |
| InChIKey | HLWPZZMQAAZQKP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The IUPAC name of [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate (CID 10603671) is [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The canonical SMILES for [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate is O=C1C=C(OS(=O)(=O)C(F)(F)F)C(=O)c2c(OS(=O)(=O)C(F)(F)F)ccc(OS(=O)(=O)C(F)(F)F)c21.
What is the InChIKey of [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The InChIKey is HLWPZZMQAAZQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H3F9O11S3/c14-11(15,16)34(25,26)31-5-1-2-6(32-35(27,28)12(17,18)19)9-8(5)4(23)3-7(10(9)24)33-36(29,30)13(20,21)22/h1-3H.
What are the key properties of [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
[5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate has a molecular weight of 602.34 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [5,8-dioxo-4,6-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate is sourced from PubChem (CID 10603671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).