C11H12IN3O2 — CID 106038920
1-[(1,5-dimethylpyrazol-4-yl)methyl]-4-iodopyrrole-2-carboxylic acid (PubChem CID 106038920) has the molecular formula C11H12IN3O2 and a molecular weight of 345.14 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methyl]-4-iodopyrrole-2-carboxylic acid.
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-4-iodopyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106038920 |
| Molecular Formula | C11H12IN3O2 |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-4-iodopyrrole-2-carboxylic acid |
| SMILES | Cc1c(Cn2cc(I)cc2C(=O)O)cnn1C |
| InChI | InChI=1S/C11H12IN3O2/c1-7-8(4-13-14(7)2)5-15-6-9(12)3-10(15)11(16)17/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | VAHMARXJHRPZGP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|