C18H28N2S — CID 106039302
1-(1-adamantyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine (PubChem CID 106039302) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine.
| Compound Name | 1-(1-adamantyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106039302 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(1-adamantyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine |
| SMILES | Cc1nc(CCNC(C)C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C18H28N2S/c1-12(19-4-3-17-11-21-13(2)20-17)18-8-14-5-15(9-18)7-16(6-14)10-18/h11-12,14-16,19H,3-10H2,1-2H3 |
| InChIKey | SITJQFURPDYARJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |