C12H12ClN3O2S — CID 106039624
5-amino-2-[2-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carboxylic acid (PubChem CID 106039624) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 5-amino-2-[2-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-2-[2-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106039624 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-amino-2-[2-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carboxylic acid |
| SMILES | Nc1cnc(NCCc2ccc(Cl)s2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12ClN3O2S/c13-10-2-1-8(19-10)3-4-15-11-9(12(17)18)5-7(14)6-16-11/h1-2,5-6H,3-4,14H2,(H,15,16)(H,17,18) |
| InChIKey | WDSONVODXGUYTK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |