C14H21BrN2OS — CID 106039918
1-[2-(5-bromothiophen-2-yl)ethyl]-3-(propylamino)piperidin-2-one (PubChem CID 106039918) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(propylamino)piperidin-2-one.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(propylamino)piperidin-2-one |
|---|---|
| PubChem CID | 106039918 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(propylamino)piperidin-2-one |
| SMILES | CCCNC1CCCN(CCc2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C14H21BrN2OS/c1-2-8-16-12-4-3-9-17(14(12)18)10-7-11-5-6-13(15)19-11/h5-6,12,16H,2-4,7-10H2,1H3 |
| InChIKey | AFULQERASCALNH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |