About [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine
[3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine (PubChem CID 106040980) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine.
Molecular Properties
| Compound Name | [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine |
| PubChem CID | 106040980 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine |
| SMILES | Cc1c(Cn2cncc2C(N)c2ccccc2)cnn1C |
| InChI | InChI=1S/C16H19N5/c1-12-14(8-19-20(12)2)10-21-11-18-9-15(21)16(17)13-6-4-3-5-7-13/h3-9,11,16H,10,17H2,1-2H3 |
| InChIKey | CXTFIDWOPNLORI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine?
The IUPAC name of [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine (CID 106040980) is [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine.
What is the SMILES notation for [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine?
The canonical SMILES for [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine is Cc1c(Cn2cncc2C(N)c2ccccc2)cnn1C.
What is the InChIKey of [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine?
The InChIKey is CXTFIDWOPNLORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5/c1-12-14(8-19-20(12)2)10-21-11-18-9-15(21)16(17)13-6-4-3-5-7-13/h3-9,11,16H,10,17H2,1-2H3.
What are the key properties of [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine?
[3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine has a molecular weight of 281.36 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1,5-dimethylpyrazol-4-yl)methyl]imidazol-4-yl]-phenylmethanamine is sourced from PubChem (CID 106040980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).