C15H23ClN2O2S — CID 106041710
tert-butyl N-[3-[2-(5-chlorothiophen-2-yl)ethylamino]cyclobutyl]carbamate (PubChem CID 106041710) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(5-chlorothiophen-2-yl)ethylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(5-chlorothiophen-2-yl)ethylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 106041710 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | tert-butyl N-[3-[2-(5-chlorothiophen-2-yl)ethylamino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NCCc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C15H23ClN2O2S/c1-15(2,3)20-14(19)18-11-8-10(9-11)17-7-6-12-4-5-13(16)21-12/h4-5,10-11,17H,6-9H2,1-3H3,(H,18,19) |
| InChIKey | GXCQIVWNXCGVBK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |