C34H66O7Si2 — CID 10604196
tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 10604196) has the molecular formula C34H66O7Si2 and a molecular weight of 643.07 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 10604196 |
| Molecular Formula | C34H66O7Si2 |
| Molecular Weight | 643.07 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=C(C[C@H]1C[C@](C)(O)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)OC(C)(C)C)O2)O1)[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H66O7Si2/c1-15-43(16-2,17-3)37-23-26(5)25(4)18-28-21-33(12,36)24-34(39-28)22-29(41-42(13,14)32(9,10)11)19-27(38-34)20-30(35)40-31(6,7)8/h26-29,36H,4,15-24H2,1-3,5-14H3/t26-,27+,28-,29-,33-,34+/m0/s1 |
| InChIKey | DRWRPIMNBNGNKW-WQYOUHQFSA-N |
| XLogP | 8.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.07 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|